1-Naphthalenesulfonamide, N-(2-chloro-4-nitrophenyl)-
CAS No: 106691-56-9
Naphthalene
106691-56-9
naphthalenesulfonamide,chloro,nitrophenyl,naphthalene,106691-56-9
2025-10-21 Discover 1-Naphthalenesulfonamide, N-(2-chloro-4-nitrophenyl)- (CAS No: 106691-56-9) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.